C15H22N4O2 — CID 121190670
cyclobutylmethyl 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 121190670) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is cyclobutylmethyl 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | cyclobutylmethyl 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121190670 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | cyclobutylmethyl 3-(4-cyclopropyltriazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCC1CCC1)N1CCC(n2cc(C3CC3)nn2)C1 |
| InChI | InChI=1S/C15H22N4O2/c20-15(21-10-11-2-1-3-11)18-7-6-13(8-18)19-9-14(16-17-19)12-4-5-12/h9,11-13H,1-8,10H2 |
| InChIKey | XUFQXJAYGLBIDC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |