About 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid
5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid (PubChem CID 119183904) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid |
| PubChem CID | 119183904 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid |
| SMILES | Cc1csc(C2CCN(C(=O)c3cc(C(=O)O)nn3-c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C20H20N4O3S/c1-13-12-28-18(21-13)14-7-9-23(10-8-14)19(25)17-11-16(20(26)27)22-24(17)15-5-3-2-4-6-15/h2-6,11-12,14H,7-10H2,1H3,(H,26,27) |
| InChIKey | LFXIJLQQFGPEHW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid?
The IUPAC name of 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid (CID 119183904) is 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid is Cc1csc(C2CCN(C(=O)c3cc(C(=O)O)nn3-c3ccccc3)CC2)n1.
What is the InChIKey of 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid?
The InChIKey is LFXIJLQQFGPEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c1-13-12-28-18(21-13)14-7-9-23(10-8-14)19(25)17-11-16(20(26)27)22-24(17)15-5-3-2-4-6-15/h2-6,11-12,14H,7-10H2,1H3,(H,26,27).
What are the key properties of 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid?
5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid has a molecular weight of 396.47 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1-phenylpyrazole-3-carboxylic acid is sourced from PubChem (CID 119183904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).