C13H17N3O2S2 — CID 124607235
(4S)-4-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 124607235) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (4S)-4-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | (4S)-4-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 124607235 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (4S)-4-[4-(4-methyl-1,3-thiazol-2-yl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | Cc1csc(C2CCN(C(=O)[C@H]3CSC(=O)N3)CC2)n1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-8-6-19-11(14-8)9-2-4-16(5-3-9)12(17)10-7-20-13(18)15-10/h6,9-10H,2-5,7H2,1H3,(H,15,18)/t10-/m1/s1 |
| InChIKey | HJKBLPSQUNBDDU-SNVBAGLBSA-N |
| XLogP | 1.98 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|