C18H29Cl2N3OS — CID 119873384
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119873384) has the molecular formula C18H29Cl2N3OS and a molecular weight of 406.42 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119873384 |
| Molecular Formula | C18H29Cl2N3OS |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1csc(C2CCCN(C(=O)C3CC4CCCCC4N3)C2)n1.Cl.Cl |
| InChI | InChI=1S/C18H27N3OS.2ClH/c1-12-11-23-17(19-12)14-6-4-8-21(10-14)18(22)16-9-13-5-2-3-7-15(13)20-16;;/h11,13-16,20H,2-10H2,1H3;2*1H |
| InChIKey | SOSQGLNKBUKNBS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |