C17H28Cl2N4OS — CID 119851684
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119851684) has the molecular formula C17H28Cl2N4OS and a molecular weight of 407.41 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119851684 |
| Molecular Formula | C17H28Cl2N4OS |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(4-methyl-1,3-thiazol-2-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1csc(N2CCN(C(=O)C3CC4CCCCC4N3)CC2)n1.Cl.Cl |
| InChI | InChI=1S/C17H26N4OS.2ClH/c1-12-11-23-17(18-12)21-8-6-20(7-9-21)16(22)15-10-13-4-2-3-5-14(13)19-15;;/h11,13-15,19H,2-10H2,1H3;2*1H |
| InChIKey | UOMWRNGAOJZQBH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |