C16H27Cl2N5OS — CID 119894225
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119894225) has the molecular formula C16H27Cl2N5OS and a molecular weight of 408.40 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119894225 |
| Molecular Formula | C16H27Cl2N5OS |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1nsc(N2CCN(C(=O)C3CC4CCCCC4N3)CC2)n1.Cl.Cl |
| InChI | InChI=1S/C16H25N5OS.2ClH/c1-11-17-16(23-19-11)21-8-6-20(7-9-21)15(22)14-10-12-4-2-3-5-13(12)18-14;;/h12-14,18H,2-10H2,1H3;2*1H |
| InChIKey | XXKHYTNTFNEZAV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |