C19H33Cl2N5O — CID 119880839
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119880839) has the molecular formula C19H33Cl2N5O and a molecular weight of 418.41 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119880839 |
| Molecular Formula | C19H33Cl2N5O |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]piperidin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1nc(C)n(CC2CCCN(C(=O)C3CC4CCCCC4N3)C2)n1.Cl.Cl |
| InChI | InChI=1S/C19H31N5O.2ClH/c1-13-20-14(2)24(22-13)12-15-6-5-9-23(11-15)19(25)18-10-16-7-3-4-8-17(16)21-18;;/h15-18,21H,3-12H2,1-2H3;2*1H |
| InChIKey | FHJIKIHISHUBAV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |