C23H35ClN4O2 — CID 119310819
1-[[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea;hydrochloride (PubChem CID 119310819) has the molecular formula C23H35ClN4O2 and a molecular weight of 435.01 g/mol. Its IUPAC name is 1-[[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea;hydrochloride.
| Compound Name | 1-[[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 119310819 |
| Molecular Formula | C23H35ClN4O2 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 1-[[1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbonyl)piperidin-3-yl]methyl]-3-(4-methylphenyl)urea;hydrochloride |
| SMILES | Cc1ccc(NC(=O)NCC2CCCN(C(=O)C3CC4CCCCC4N3)C2)cc1.Cl |
| InChI | InChI=1S/C23H34N4O2.ClH/c1-16-8-10-19(11-9-16)25-23(29)24-14-17-5-4-12-27(15-17)22(28)21-13-18-6-2-3-7-20(18)26-21;/h8-11,17-18,20-21,26H,2-7,12-15H2,1H3,(H2,24,25,29);1H |
| InChIKey | FOELRHSIIRIUJA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |