C20H28ClFN2O — CID 119326399
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methanone;hydrochloride (PubChem CID 119326399) has the molecular formula C20H28ClFN2O and a molecular weight of 366.91 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119326399 |
| Molecular Formula | C20H28ClFN2O |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC2CCCCC2N1)N1CCC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H27FN2O.ClH/c21-17-7-5-14(6-8-17)11-15-9-10-23(13-15)20(24)19-12-16-3-1-2-4-18(16)22-19;/h5-8,15-16,18-19,22H,1-4,9-13H2;1H |
| InChIKey | GPSBCYWDDMTCAG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |