C15H27ClN2O — CID 119345006
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(3-ethylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 119345006) has the molecular formula C15H27ClN2O and a molecular weight of 286.85 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(3-ethylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(3-ethylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119345006 |
| Molecular Formula | C15H27ClN2O |
| Molecular Weight | 286.85 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-(3-ethylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | CCC1CCN(C(=O)C2CC3CCCCC3N2)C1.Cl |
| InChI | InChI=1S/C15H26N2O.ClH/c1-2-11-7-8-17(10-11)15(18)14-9-12-5-3-4-6-13(12)16-14;/h11-14,16H,2-10H2,1H3;1H |
| InChIKey | QCRABKBMPBRQDF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |