C18H30F3N3O — CID 119896764
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methanone (PubChem CID 119896764) has the molecular formula C18H30F3N3O and a molecular weight of 361.45 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 119896764 |
| Molecular Formula | C18H30F3N3O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCN(CC1CCN(C(=O)C2CC3CCCCC3N2)C1)CC(F)(F)F |
| InChI | InChI=1S/C18H30F3N3O/c1-2-23(12-18(19,20)21)10-13-7-8-24(11-13)17(25)16-9-14-5-3-4-6-15(14)22-16/h13-16,22H,2-12H2,1H3 |
| InChIKey | IRTOWSDKDKBVPW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |