C17H33Cl2N3O — CID 119843254
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(diethylamino)pyrrolidin-1-yl]methanone;dihydrochloride (PubChem CID 119843254) has the molecular formula C17H33Cl2N3O and a molecular weight of 366.38 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(diethylamino)pyrrolidin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(diethylamino)pyrrolidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119843254 |
| Molecular Formula | C17H33Cl2N3O |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[3-(diethylamino)pyrrolidin-1-yl]methanone;dihydrochloride |
| SMILES | CCN(CC)C1CCN(C(=O)C2CC3CCCCC3N2)C1.Cl.Cl |
| InChI | InChI=1S/C17H31N3O.2ClH/c1-3-19(4-2)14-9-10-20(12-14)17(21)16-11-13-7-5-6-8-15(13)18-16;;/h13-16,18H,3-12H2,1-2H3;2*1H |
| InChIKey | OURYDHMDJFBHEC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |