C13H20N2O2S — CID 124623176
(2S)-2-[4-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid (PubChem CID 124623176) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2S)-2-[4-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-[4-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 124623176 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2S)-2-[4-(4-methyl-1,3-thiazol-2-yl)piperidin-1-yl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)N1CCC(c2nc(C)cs2)CC1 |
| InChI | InChI=1S/C13H20N2O2S/c1-3-11(13(16)17)15-6-4-10(5-7-15)12-14-9(2)8-18-12/h8,10-11H,3-7H2,1-2H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | PFJUOWCVOIWBHZ-NSHDSACASA-N |
| XLogP | 2.49 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |