C8H14ClN3O2S — CID 119483069
(4R)-4-(3-aminopyrrolidine-1-carbonyl)-1,3-thiazolidin-2-one;hydrochloride (PubChem CID 119483069) has the molecular formula C8H14ClN3O2S and a molecular weight of 251.74 g/mol. Its IUPAC name is (4R)-4-(3-aminopyrrolidine-1-carbonyl)-1,3-thiazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-(3-aminopyrrolidine-1-carbonyl)-1,3-thiazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119483069 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (4R)-4-(3-aminopyrrolidine-1-carbonyl)-1,3-thiazolidin-2-one;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)[C@@H]2CSC(=O)N2)C1 |
| InChI | InChI=1S/C8H13N3O2S.ClH/c9-5-1-2-11(3-5)7(12)6-4-14-8(13)10-6;/h5-6H,1-4,9H2,(H,10,13);1H/t5?,6-;/m0./s1 |
| InChIKey | CUXMJEZXMZNNEL-PQAGPIFVSA-N |
| XLogP | -0.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|