C11H14N2O6S — CID 115918403
1-(2-oxo-1,3-thiazolidine-4-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 115918403) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 1-(2-oxo-1,3-thiazolidine-4-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(2-oxo-1,3-thiazolidine-4-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918403 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(2-oxo-1,3-thiazolidine-4-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | O=C1NC(C(=O)N2CCC(C(=O)O)C(C(=O)O)C2)CS1 |
| InChI | InChI=1S/C11H14N2O6S/c14-8(7-4-20-11(19)12-7)13-2-1-5(9(15)16)6(3-13)10(17)18/h5-7H,1-4H2,(H,12,19)(H,15,16)(H,17,18) |
| InChIKey | LCBFJWPVBQIQMA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|