C10H11F3N2O4S — CID 63710319
1-(2-oxo-1,3-thiazolidine-4-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63710319) has the molecular formula C10H11F3N2O4S and a molecular weight of 312.27 g/mol. Its IUPAC name is 1-(2-oxo-1,3-thiazolidine-4-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-oxo-1,3-thiazolidine-4-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63710319 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 1-(2-oxo-1,3-thiazolidine-4-carbonyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C1NC(C(=O)N2CCC(C(=O)O)(C(F)(F)F)C2)CS1 |
| InChI | InChI=1S/C10H11F3N2O4S/c11-10(12,13)9(7(17)18)1-2-15(4-9)6(16)5-3-20-8(19)14-5/h5H,1-4H2,(H,14,19)(H,17,18) |
| InChIKey | MGJRZZGSBWUNAH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|