C12H18N2O2S — CID 99775088
(4S)-4-(2-azaspiro[4.4]nonane-2-carbonyl)-1,3-thiazolidin-2-one (PubChem CID 99775088) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is (4S)-4-(2-azaspiro[4.4]nonane-2-carbonyl)-1,3-thiazolidin-2-one.
| Compound Name | (4S)-4-(2-azaspiro[4.4]nonane-2-carbonyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 99775088 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (4S)-4-(2-azaspiro[4.4]nonane-2-carbonyl)-1,3-thiazolidin-2-one |
| SMILES | O=C1N[C@@H](C(=O)N2CCC3(CCCC3)C2)CS1 |
| InChI | InChI=1S/C12H18N2O2S/c15-10(9-7-17-11(16)13-9)14-6-5-12(8-14)3-1-2-4-12/h9H,1-8H2,(H,13,16)/t9-/m1/s1 |
| InChIKey | BREHFZMYKHYKBP-SECBINFHSA-N |
| XLogP | 1.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|