C19H25N3O5S2 — CID 74226589
(4R)-4-[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 74226589) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (4R)-4-[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 74226589 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (4R)-4-[8-(3-methoxyphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | COc1cccc(S(=O)(=O)N2CCC3(CCN(C(=O)[C@@H]4CSC(=O)N4)C3)CC2)c1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-27-14-3-2-4-15(11-14)29(25,26)22-9-6-19(7-10-22)5-8-21(13-19)17(23)16-12-28-18(24)20-16/h2-4,11,16H,5-10,12-13H2,1H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | XPOZPBDSPRGXPW-INIZCTEOSA-N |
| XLogP | 1.52 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|