C26H35N3O3S2 — CID 4997900
8-(3-methoxyphenyl)sulfonyl-N-(2-methyl-6-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 4997900) has the molecular formula C26H35N3O3S2 and a molecular weight of 501.72 g/mol. Its IUPAC name is 8-(3-methoxyphenyl)sulfonyl-N-(2-methyl-6-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(3-methoxyphenyl)sulfonyl-N-(2-methyl-6-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 4997900 |
| Molecular Formula | C26H35N3O3S2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 8-(3-methoxyphenyl)sulfonyl-N-(2-methyl-6-propan-2-ylphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | COc1cccc(S(=O)(=O)N2CCC3(CCN(C(=S)Nc4c(C)cccc4C(C)C)C3)CC2)c1 |
| InChI | InChI=1S/C26H35N3O3S2/c1-19(2)23-10-5-7-20(3)24(23)27-25(33)28-14-11-26(18-28)12-15-29(16-13-26)34(30,31)22-9-6-8-21(17-22)32-4/h5-10,17,19H,11-16,18H2,1-4H3,(H,27,33) |
| InChIKey | NZASWWAMWVHRBL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|