C17H24N2O4S — CID 110818032
cyclopentyl-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 110818032) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is cyclopentyl-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | cyclopentyl-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110818032 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | cyclopentyl-[4-(3-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1cccc(S(=O)(=O)N2CCN(C(=O)C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C17H24N2O4S/c1-23-15-7-4-8-16(13-15)24(21,22)19-11-9-18(10-12-19)17(20)14-5-2-3-6-14/h4,7-8,13-14H,2-3,5-6,9-12H2,1H3 |
| InChIKey | VZIBXTNXZBNBIA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |