C10H14N2O4S — CID 28789368
1-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]piperidine-4-carboxylic acid (PubChem CID 28789368) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 28789368 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]piperidine-4-carboxylic acid |
| SMILES | O=C1N[C@H](C(=O)N2CCC(C(=O)O)CC2)CS1 |
| InChI | InChI=1S/C10H14N2O4S/c13-8(7-5-17-10(16)11-7)12-3-1-6(2-4-12)9(14)15/h6-7H,1-5H2,(H,11,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | IHZNTOCAGXYWTK-ZETCQYMHSA-N |
| XLogP | 0.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|