C8H10N2O4S2 — CID 61144554
(4R)-3-(2-oxo-1,3-thiazolidine-4-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61144554) has the molecular formula C8H10N2O4S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4R)-3-(2-oxo-1,3-thiazolidine-4-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2-oxo-1,3-thiazolidine-4-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61144554 |
| Molecular Formula | C8H10N2O4S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | (4R)-3-(2-oxo-1,3-thiazolidine-4-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C1NC(C(=O)N2CSC[C@H]2C(=O)O)CS1 |
| InChI | InChI=1S/C8H10N2O4S2/c11-6(4-1-16-8(14)9-4)10-3-15-2-5(10)7(12)13/h4-5H,1-3H2,(H,9,14)(H,12,13)/t4?,5-/m0/s1 |
| InChIKey | YQOHJOBARNRRHJ-AKGZTFGVSA-N |
| XLogP | -0.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|