C11H19N3O2S — CID 119520526
(4R)-4-[4-(1-aminoethyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one (PubChem CID 119520526) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is (4R)-4-[4-(1-aminoethyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-[4-(1-aminoethyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 119520526 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (4R)-4-[4-(1-aminoethyl)piperidine-1-carbonyl]-1,3-thiazolidin-2-one |
| SMILES | CC(N)C1CCN(C(=O)[C@@H]2CSC(=O)N2)CC1 |
| InChI | InChI=1S/C11H19N3O2S/c1-7(12)8-2-4-14(5-3-8)10(15)9-6-17-11(16)13-9/h7-9H,2-6,12H2,1H3,(H,13,16)/t7?,9-/m0/s1 |
| InChIKey | HZQBVNIIJXSPLN-NETXQHHPSA-N |
| XLogP | 0.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|