C20H26N4O4S — CID 74224172
N-(2-methoxyphenyl)-2-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 74224172) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 74224172 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(4R)-2-oxo-1,3-thiazolidine-4-carbonyl]-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCC2(CC1)CCN(C(=O)[C@@H]1CSC(=O)N1)C2 |
| InChI | InChI=1S/C20H26N4O4S/c1-28-16-5-3-2-4-14(16)21-18(26)23-9-6-20(7-10-23)8-11-24(13-20)17(25)15-12-29-19(27)22-15/h2-5,15H,6-13H2,1H3,(H,21,26)(H,22,27)/t15-/m0/s1 |
| InChIKey | JZHCPKZRIBRJKF-HNNXBMFYSA-N |
| XLogP | 2.37 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|