C21H27N3O4 — CID 3863013
but-2-ynyl 8-[(2-methoxyphenyl)carbamoyl]-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 3863013) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is but-2-ynyl 8-[(2-methoxyphenyl)carbamoyl]-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | but-2-ynyl 8-[(2-methoxyphenyl)carbamoyl]-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 3863013 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | but-2-ynyl 8-[(2-methoxyphenyl)carbamoyl]-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC2(CCN(C(=O)Nc3ccccc3OC)CC2)C1 |
| InChI | InChI=1S/C21H27N3O4/c1-3-4-15-28-20(26)24-14-11-21(16-24)9-12-23(13-10-21)19(25)22-17-7-5-6-8-18(17)27-2/h5-8H,9-16H2,1-2H3,(H,22,25) |
| InChIKey | RZFCMBFLKWDMBR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|