C24H27N3O3 — CID 3605670
but-2-ynyl 8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 3605670) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is but-2-ynyl 8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | but-2-ynyl 8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 3605670 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | but-2-ynyl 8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC2(CCN(C(=O)c3ccccc3-n3cccc3)CC2)C1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-18-30-23(29)27-17-12-24(19-27)10-15-26(16-11-24)22(28)20-8-4-5-9-21(20)25-13-6-7-14-25/h4-9,13-14H,10-12,15-19H2,1H3 |
| InChIKey | FRBQUISSWPDWAN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|