C28H33N3O4 — CID 74226866
methyl (1S,6R)-6-[8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]cyclohex-3-ene-1-carboxylate (PubChem CID 74226866) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl (1S,6R)-6-[8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6R)-6-[8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 74226866 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | methyl (1S,6R)-6-[8-(2-pyrrol-1-ylbenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CC[C@H]1C(=O)N1CCC2(CCN(C(=O)c3ccccc3-n3cccc3)CC2)C1 |
| InChI | InChI=1S/C28H33N3O4/c1-35-27(34)22-9-3-2-8-21(22)25(32)31-19-14-28(20-31)12-17-30(18-13-28)26(33)23-10-4-5-11-24(23)29-15-6-7-16-29/h2-7,10-11,15-16,21-22H,8-9,12-14,17-20H2,1H3/t21-,22+/m1/s1 |
| InChIKey | OKIHSLZEOIBBJM-YADHBBJMSA-N |
| XLogP | 3.69 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|