C22H27N3O2 — CID 97407738
1-[2-(2-pyrrol-1-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone (PubChem CID 97407738) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-[2-(2-pyrrol-1-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone.
| Compound Name | 1-[2-(2-pyrrol-1-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone |
|---|---|
| PubChem CID | 97407738 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[2-(2-pyrrol-1-ylbenzoyl)-2,9-diazaspiro[5.5]undecan-9-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CCCN(C(=O)c3ccccc3-n3cccc3)C2)CC1 |
| InChI | InChI=1S/C22H27N3O2/c1-18(26)23-15-10-22(11-16-23)9-6-14-25(17-22)21(27)19-7-2-3-8-20(19)24-12-4-5-13-24/h2-5,7-8,12-13H,6,9-11,14-17H2,1H3 |
| InChIKey | NJEIVOHSXVULML-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |