C20H25N3O3S — CID 3809575
but-2-ynyl 8-(2-methylsulfanylpyridine-3-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate (PubChem CID 3809575) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is but-2-ynyl 8-(2-methylsulfanylpyridine-3-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate.
| Compound Name | but-2-ynyl 8-(2-methylsulfanylpyridine-3-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 3809575 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | but-2-ynyl 8-(2-methylsulfanylpyridine-3-carbonyl)-2,8-diazaspiro[4.5]decane-2-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC2(CCN(C(=O)c3cccnc3SC)CC2)C1 |
| InChI | InChI=1S/C20H25N3O3S/c1-3-4-14-26-19(25)23-13-9-20(15-23)7-11-22(12-8-20)18(24)16-6-5-10-21-17(16)27-2/h5-6,10H,7-9,11-15H2,1-2H3 |
| InChIKey | PGHAVBMIJJNGMX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|