C22H21F5N4OS2 — CID 3866845
8-(2-methylsulfanylpyridine-3-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3866845) has the molecular formula C22H21F5N4OS2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 8-(2-methylsulfanylpyridine-3-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(2-methylsulfanylpyridine-3-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3866845 |
| Molecular Formula | C22H21F5N4OS2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 8-(2-methylsulfanylpyridine-3-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | CSc1ncccc1C(=O)N1CCC2(CC1)CCN(C(=S)Nc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C22H21F5N4OS2/c1-34-19-12(3-2-7-28-19)20(32)30-8-4-22(5-9-30)6-10-31(11-22)21(33)29-18-16(26)14(24)13(23)15(25)17(18)27/h2-3,7H,4-6,8-11H2,1H3,(H,29,33) |
| InChIKey | LBKFNLMSZFBZKN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|