C22H20F5N3O2S2 — CID 3780780
8-(5-acetylthiophene-2-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3780780) has the molecular formula C22H20F5N3O2S2 and a molecular weight of 517.55 g/mol. Its IUPAC name is 8-(5-acetylthiophene-2-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(5-acetylthiophene-2-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3780780 |
| Molecular Formula | C22H20F5N3O2S2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 8-(5-acetylthiophene-2-carbonyl)-N-(2,3,4,5,6-pentafluorophenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC3(CC2)CCN(C(=S)Nc2c(F)c(F)c(F)c(F)c2F)C3)s1 |
| InChI | InChI=1S/C22H20F5N3O2S2/c1-11(31)12-2-3-13(34-12)20(32)29-7-4-22(5-8-29)6-9-30(10-22)21(33)28-19-17(26)15(24)14(23)16(25)18(19)27/h2-3H,4-10H2,1H3,(H,28,33) |
| InChIKey | AWGORARCRGAYQX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|