C21H25N5O5S — CID 3870106
1-[5-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]thiophen-2-yl]ethanone (PubChem CID 3870106) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 1-[5-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 3870106 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[5-[2-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)-2,8-diazaspiro[4.5]decane-8-carbonyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC3(CC2)CCN(C(=O)c2c([N+](=O)[O-])c(C)nn2C)C3)s1 |
| InChI | InChI=1S/C21H25N5O5S/c1-13-17(26(30)31)18(23(3)22-13)20(29)25-11-8-21(12-25)6-9-24(10-7-21)19(28)16-5-4-15(32-16)14(2)27/h4-5H,6-12H2,1-3H3 |
| InChIKey | BYDVIDXCFGOODC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|