C24H23F3N2O3S — CID 3333851
1-[8-(5-acetylthiophene-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one (PubChem CID 3333851) has the molecular formula C24H23F3N2O3S and a molecular weight of 476.52 g/mol. Its IUPAC name is 1-[8-(5-acetylthiophene-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[8-(5-acetylthiophene-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3333851 |
| Molecular Formula | C24H23F3N2O3S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-[8-(5-acetylthiophene-2-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one |
| SMILES | CC(=O)c1ccc(C(=O)N2CCC3(CCN(C(=O)C=Cc4ccc(F)c(F)c4F)C3)CC2)s1 |
| InChI | InChI=1S/C24H23F3N2O3S/c1-15(30)18-5-6-19(33-18)23(32)28-11-8-24(9-12-28)10-13-29(14-24)20(31)7-3-16-2-4-17(25)22(27)21(16)26/h2-7H,8-14H2,1H3 |
| InChIKey | ODFLCOIIEJENHO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|