C25H27F3N2O3S — CID 3862062
1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one (PubChem CID 3862062) has the molecular formula C25H27F3N2O3S and a molecular weight of 492.56 g/mol. Its IUPAC name is 1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one.
| Compound Name | 1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3862062 |
| Molecular Formula | C25H27F3N2O3S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-3-(2,3,4-trifluorophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC3(CCN(C(=O)C=Cc4ccc(F)c(F)c4F)C3)CC2)c1 |
| InChI | InChI=1S/C25H27F3N2O3S/c1-17-3-4-18(2)21(15-17)34(32,33)30-13-10-25(11-14-30)9-12-29(16-25)22(31)8-6-19-5-7-20(26)24(28)23(19)27/h3-8,15H,9-14,16H2,1-2H3 |
| InChIKey | GUEJKDDTDNXTCF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|