C24H35N3O4S — CID 74226107
N-[(2S)-1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-4-methyl-1-oxopent-4-en-2-yl]acetamide (PubChem CID 74226107) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[(2S)-1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-4-methyl-1-oxopent-4-en-2-yl]acetamide.
| Compound Name | N-[(2S)-1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-4-methyl-1-oxopent-4-en-2-yl]acetamide |
|---|---|
| PubChem CID | 74226107 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-[(2S)-1-[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]-4-methyl-1-oxopent-4-en-2-yl]acetamide |
| SMILES | C=C(C)C[C@H](NC(C)=O)C(=O)N1CCC2(CCN(S(=O)(=O)c3cc(C)ccc3C)CC2)C1 |
| InChI | InChI=1S/C24H35N3O4S/c1-17(2)14-21(25-20(5)28)23(29)26-11-8-24(16-26)9-12-27(13-10-24)32(30,31)22-15-18(3)6-7-19(22)4/h6-7,15,21H,1,8-14,16H2,2-5H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | QUJINJZZMWBYSJ-NRFANRHFSA-N |
| XLogP | 2.78 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|