C23H32N4O5 — CID 74226717
N-[2-[2-[(2S)-2-acetamido-4-methylpent-4-enoyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 74226717) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-[2-[2-[(2S)-2-acetamido-4-methylpent-4-enoyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[2-[(2S)-2-acetamido-4-methylpent-4-enoyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 74226717 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N-[2-[2-[(2S)-2-acetamido-4-methylpent-4-enoyl]-2,8-diazaspiro[4.5]decan-8-yl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | C=C(C)C[C@H](NC(C)=O)C(=O)N1CCC2(CCN(C(=O)CNC(=O)c3ccco3)CC2)C1 |
| InChI | InChI=1S/C23H32N4O5/c1-16(2)13-18(25-17(3)28)22(31)27-11-8-23(15-27)6-9-26(10-7-23)20(29)14-24-21(30)19-5-4-12-32-19/h4-5,12,18H,1,6-11,13-15H2,2-3H3,(H,24,30)(H,25,28)/t18-/m0/s1 |
| InChIKey | XBJFILTUROHTBV-SFHVURJKSA-N |
| XLogP | 1.32 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|