C13H17F2NO2S — CID 139027359
1-(2,5-dimethylphenyl)sulfonyl-4,4-difluoropiperidine (PubChem CID 139027359) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4,4-difluoropiperidine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4,4-difluoropiperidine |
|---|---|
| PubChem CID | 139027359 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4,4-difluoropiperidine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-10-3-4-11(2)12(9-10)19(17,18)16-7-5-13(14,15)6-8-16/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | KEBGTVBNCNPHKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |