C25H37N3O2S2 — CID 3696878
N-[2-(cyclohexen-1-yl)ethyl]-8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3696878) has the molecular formula C25H37N3O2S2 and a molecular weight of 475.72 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3696878 |
| Molecular Formula | C25H37N3O2S2 |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC3(CCN(C(=S)NCCC4=CCCCC4)C3)CC2)c1 |
| InChI | InChI=1S/C25H37N3O2S2/c1-20-8-9-21(2)23(18-20)32(29,30)28-16-12-25(13-17-28)11-15-27(19-25)24(31)26-14-10-22-6-4-3-5-7-22/h6,8-9,18H,3-5,7,10-17,19H2,1-2H3,(H,26,31) |
| InChIKey | BTVMOEAIMMQXHZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|