C11H16N4O3 — CID 20549924
(1,3-dimethyl-4-nitropyrazol-5-yl)-piperidin-1-ylmethanone (PubChem CID 20549924) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is (1,3-dimethyl-4-nitropyrazol-5-yl)-piperidin-1-ylmethanone.
| Compound Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 20549924 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-piperidin-1-ylmethanone |
| SMILES | Cc1nn(C)c(C(=O)N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O3/c1-8-9(15(17)18)10(13(2)12-8)11(16)14-6-4-3-5-7-14/h3-7H2,1-2H3 |
| InChIKey | HVKHJXFSRFQTII-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|