C15H21N7O5S — CID 19479040
(1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone (PubChem CID 19479040) has the molecular formula C15H21N7O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19479040 |
| Molecular Formula | C15H21N7O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1nn(C)c(C(=O)N2CCN(S(=O)(=O)c3cnn(C)c3C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N7O5S/c1-10-13(22(24)25)14(19(4)17-10)15(23)20-5-7-21(8-6-20)28(26,27)12-9-16-18(3)11(12)2/h9H,5-8H2,1-4H3 |
| InChIKey | OUOWVEPROZFVDM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 136.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|