C14H19N7O5S — CID 19531348
1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone (PubChem CID 19531348) has the molecular formula C14H19N7O5S and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 19531348 |
| Molecular Formula | C14H19N7O5S |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-(4-nitropyrazol-1-yl)ethanone |
| SMILES | Cc1c(S(=O)(=O)N2CCN(C(=O)Cn3cc([N+](=O)[O-])cn3)CC2)cnn1C |
| InChI | InChI=1S/C14H19N7O5S/c1-11-13(8-15-17(11)2)27(25,26)20-5-3-18(4-6-20)14(22)10-19-9-12(7-16-19)21(23)24/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | FCPICTPPCPVTRD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 136.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|