C17H25N7O5S — CID 19540353
1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propan-1-one (PubChem CID 19540353) has the molecular formula C17H25N7O5S and a molecular weight of 439.50 g/mol. Its IUPAC name is 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propan-1-one.
| Compound Name | 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 19540353 |
| Molecular Formula | C17H25N7O5S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[4-(1,5-dimethylpyrazol-4-yl)sulfonylpiperazin-1-yl]-2-methyl-3-(5-methyl-3-nitropyrazol-1-yl)propan-1-one |
| SMILES | Cc1c(S(=O)(=O)N2CCN(C(=O)C(C)Cn3nc([N+](=O)[O-])cc3C)CC2)cnn1C |
| InChI | InChI=1S/C17H25N7O5S/c1-12(11-23-13(2)9-16(19-23)24(26)27)17(25)21-5-7-22(8-6-21)30(28,29)15-10-18-20(4)14(15)3/h9-10,12H,5-8,11H2,1-4H3 |
| InChIKey | CFOVYZAGJZRQNY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 136.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|