C26H28N6O4 — CID 3803159
1,3-dihydroisoindol-2-yl-[2-[1-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)piperidin-4-yl]-6-methyl-3-pyridinyl]methanone (PubChem CID 3803159) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is 1,3-dihydroisoindol-2-yl-[2-[1-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)piperidin-4-yl]-6-methyl-3-pyridinyl]methanone.
| Compound Name | 1,3-dihydroisoindol-2-yl-[2-[1-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 3803159 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1,3-dihydroisoindol-2-yl-[2-[1-(1,3-dimethyl-4-nitropyrazole-5-carbonyl)piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
| SMILES | Cc1ccc(C(=O)N2Cc3ccccc3C2)c(C2CCN(C(=O)c3c([N+](=O)[O-])c(C)nn3C)CC2)n1 |
| InChI | InChI=1S/C26H28N6O4/c1-16-8-9-21(25(33)31-14-19-6-4-5-7-20(19)15-31)22(27-16)18-10-12-30(13-11-18)26(34)24-23(32(35)36)17(2)28-29(24)3/h4-9,18H,10-15H2,1-3H3 |
| InChIKey | JFZJWZGCBAJIFK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 114.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|