C22H23FN4O4S — CID 4999895
(2-fluoro-4-nitrophenyl)-[4-[6-methyl-3-(1,3-thiazolidine-3-carbonyl)-2-pyridinyl]piperidin-1-yl]methanone (PubChem CID 4999895) has the molecular formula C22H23FN4O4S and a molecular weight of 458.52 g/mol. Its IUPAC name is (2-fluoro-4-nitrophenyl)-[4-[6-methyl-3-(1,3-thiazolidine-3-carbonyl)-2-pyridinyl]piperidin-1-yl]methanone.
| Compound Name | (2-fluoro-4-nitrophenyl)-[4-[6-methyl-3-(1,3-thiazolidine-3-carbonyl)-2-pyridinyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 4999895 |
| Molecular Formula | C22H23FN4O4S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (2-fluoro-4-nitrophenyl)-[4-[6-methyl-3-(1,3-thiazolidine-3-carbonyl)-2-pyridinyl]piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCSC2)c(C2CCN(C(=O)c3ccc([N+](=O)[O-])cc3F)CC2)n1 |
| InChI | InChI=1S/C22H23FN4O4S/c1-14-2-4-18(22(29)26-10-11-32-13-26)20(24-14)15-6-8-25(9-7-15)21(28)17-5-3-16(27(30)31)12-19(17)23/h2-5,12,15H,6-11,13H2,1H3 |
| InChIKey | FIFOPGMYWOMRBZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|