C25H30N4O4 — CID 42852080
[4-[6-methyl-3-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42852080) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is [4-[6-methyl-3-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[6-methyl-3-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42852080 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [4-[6-methyl-3-(4-methylpiperidine-1-carbonyl)-2-pyridinyl]piperidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC(C)CC2)c(C2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C25H30N4O4/c1-17-9-13-28(14-10-17)25(31)22-8-3-18(2)26-23(22)19-11-15-27(16-12-19)24(30)20-4-6-21(7-5-20)29(32)33/h3-8,17,19H,9-16H2,1-2H3 |
| InChIKey | GDWLYKYQDYHGQY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|