C28H34FN3O2 — CID 42868099
[4-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 42868099) has the molecular formula C28H34FN3O2 and a molecular weight of 463.60 g/mol. Its IUPAC name is [4-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 42868099 |
| Molecular Formula | C28H34FN3O2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [4-[3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl)-6-methyl-2-pyridinyl]piperidin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCC3CCCCC3C2)c(C2CCN(C(=O)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C28H34FN3O2/c1-19-6-11-25(28(34)32-17-12-20-4-2-3-5-23(20)18-32)26(30-19)21-13-15-31(16-14-21)27(33)22-7-9-24(29)10-8-22/h6-11,20-21,23H,2-5,12-18H2,1H3 |
| InChIKey | NOLSZQAZBFMRBY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |