C31H43N3O — CID 92998327
[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-methyl-2-[1-[(4-propan-2-ylphenyl)methyl]piperidin-4-yl]-3-pyridinyl]methanone (PubChem CID 92998327) has the molecular formula C31H43N3O and a molecular weight of 473.71 g/mol. Its IUPAC name is [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-methyl-2-[1-[(4-propan-2-ylphenyl)methyl]piperidin-4-yl]-3-pyridinyl]methanone.
| Compound Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-methyl-2-[1-[(4-propan-2-ylphenyl)methyl]piperidin-4-yl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 92998327 |
| Molecular Formula | C31H43N3O |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | [(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-methyl-2-[1-[(4-propan-2-ylphenyl)methyl]piperidin-4-yl]-3-pyridinyl]methanone |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3CCCC[C@H]3C2)c(C2CCN(Cc3ccc(C(C)C)cc3)CC2)n1 |
| InChI | InChI=1S/C31H43N3O/c1-22(2)25-11-9-24(10-12-25)20-33-17-14-27(15-18-33)30-29(13-8-23(3)32-30)31(35)34-19-16-26-6-4-5-7-28(26)21-34/h8-13,22,26-28H,4-7,14-21H2,1-3H3/t26-,28-/m0/s1 |
| InChIKey | ULQRWVGYHWJEHD-XCZPVHLTSA-N |
| XLogP | 6.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |