C28H38N4O2 — CID 42867590
(4-cyclopentylpiperazin-1-yl)-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone (PubChem CID 42867590) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 42867590 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[2-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(C3CCCC3)CC2)c(C2CCN(Cc3ccccc3O)CC2)n1 |
| InChI | InChI=1S/C28H38N4O2/c1-21-10-11-25(28(34)32-18-16-31(17-19-32)24-7-3-4-8-24)27(29-21)22-12-14-30(15-13-22)20-23-6-2-5-9-26(23)33/h2,5-6,9-11,22,24,33H,3-4,7-8,12-20H2,1H3 |
| InChIKey | IXUUYXDDVLQFHN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|