C28H36FN3O — CID 92998769
[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone (PubChem CID 92998769) has the molecular formula C28H36FN3O and a molecular weight of 449.61 g/mol. Its IUPAC name is [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone.
| Compound Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 92998769 |
| Molecular Formula | C28H36FN3O |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | [(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[2-[1-[(3-fluorophenyl)methyl]piperidin-4-yl]-6-methyl-3-pyridinyl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCC[C@H]3CCCC[C@@H]32)c(C2CCN(Cc3cccc(F)c3)CC2)n1 |
| InChI | InChI=1S/C28H36FN3O/c1-20-11-12-25(28(33)32-15-5-8-22-7-2-3-10-26(22)32)27(30-20)23-13-16-31(17-14-23)19-21-6-4-9-24(29)18-21/h4,6,9,11-12,18,22-23,26H,2-3,5,7-8,10,13-17,19H2,1H3/t22-,26+/m1/s1 |
| InChIKey | UFDNIFQKAXHHNG-GJZUVCINSA-N |
| XLogP | 5.70 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |