C18H23N9O3 — CID 35758490
(1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]methanone (PubChem CID 35758490) has the molecular formula C18H23N9O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]methanone.
| Compound Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 35758490 |
| Molecular Formula | C18H23N9O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (1,3-dimethyl-4-nitropyrazol-5-yl)-[4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(N2CCN(C(=O)c3c([N+](=O)[O-])c(C)nn3C)CC2)c2c(n1)c(C)nn2C |
| InChI | InChI=1S/C18H23N9O3/c1-10-13-15(23(4)21-10)17(20-12(3)19-13)25-6-8-26(9-7-25)18(28)16-14(27(29)30)11(2)22-24(16)5/h6-9H2,1-5H3 |
| InChIKey | BRAJQVZNLLQQMM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 128.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|